Classification of Aldose and Ketose, Glycosidic Linkage, Monosaccharide Oxidation and Reduction, Fat
Answered
Task
1. Classify the following as an aldose or a ketose, and according to the number of C.
2. Circle the glycosidic linkage and identify it as a or b
3. Draw the products of the oxidation and reduction of the following monosaccharides.
![](https://cdn5.myassignmenthelp.com/3-1637641393.png)
4. Draw a skeletal structure of the following fatty acids. Label the hydrophobic portion of each molecule. Circle the fatty acid with the lower melting point.
CH3(CH2)16COOH CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
5. Identify the following as a triglyceride or a phosphoglyceride. Circle the glycerol backbone in each and draw the products formed when each triglyceride undergoes hydrolysis.
6. Which lipid of the lipids in #5 would be present in a cell membrane. Explain.